C13H14N2O4S2 — CID 133440508
N-[(2-methylphenyl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine (PubChem CID 133440508) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine.
| Compound Name | N-[(2-methylphenyl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 133440508 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
| SMILES | Cc1ccccc1CNc1sc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O4S2/c1-9-5-3-4-6-10(9)8-14-13-11(15(16)17)7-12(20-13)21(2,18)19/h3-7,14H,8H2,1-2H3 |
| InChIKey | SFSNMXMJFTVLLK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|