C10H10ClN5O3 — CID 79238315
6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 79238315) has the molecular formula C10H10ClN5O3 and a molecular weight of 283.68 g/mol. Its IUPAC name is 6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 79238315 |
| Molecular Formula | C10H10ClN5O3 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1noc(C)c1CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClN5O3/c1-5-7(6(2)19-15-5)3-12-10-8(16(17)18)9(11)13-4-14-10/h4H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | BICVRAWFDPDYSF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|