C9H8ClN5O3 — CID 62101050
6-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 62101050) has the molecular formula C9H8ClN5O3 and a molecular weight of 269.65 g/mol. Its IUPAC name is 6-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 62101050 |
| Molecular Formula | C9H8ClN5O3 |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 6-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(CNc2ncnc(Cl)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C9H8ClN5O3/c1-5-2-6(14-18-5)3-11-9-7(15(16)17)8(10)12-4-13-9/h2,4H,3H2,1H3,(H,11,12,13) |
| InChIKey | RXXKHLUXDYNNRL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|