C10H9BrN4O3 — CID 79534435
3-bromo-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine (PubChem CID 79534435) has the molecular formula C10H9BrN4O3 and a molecular weight of 313.11 g/mol. Its IUPAC name is 3-bromo-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 79534435 |
| Molecular Formula | C10H9BrN4O3 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 3-bromo-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine |
| SMILES | Cc1cc(CNc2ncc([N+](=O)[O-])cc2Br)no1 |
| InChI | InChI=1S/C10H9BrN4O3/c1-6-2-7(14-18-6)4-12-10-9(11)3-8(5-13-10)15(16)17/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | XCGMMOHOIIECLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|