C9H12BrN3O3 — CID 79535072
1-[(3-bromo-5-nitro-2-pyridinyl)amino]-2-methylpropan-2-ol (PubChem CID 79535072) has the molecular formula C9H12BrN3O3 and a molecular weight of 290.12 g/mol. Its IUPAC name is 1-[(3-bromo-5-nitro-2-pyridinyl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[(3-bromo-5-nitro-2-pyridinyl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79535072 |
| Molecular Formula | C9H12BrN3O3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1-[(3-bromo-5-nitro-2-pyridinyl)amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H12BrN3O3/c1-9(2,14)5-12-8-7(10)3-6(4-11-8)13(15)16/h3-4,14H,5H2,1-2H3,(H,11,12) |
| InChIKey | LTKFBWVGEYKFLX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|