C13H18BrN3O4 — CID 133350091
methyl 3-[(3-bromo-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoate (PubChem CID 133350091) has the molecular formula C13H18BrN3O4 and a molecular weight of 360.21 g/mol. Its IUPAC name is methyl 3-[(3-bromo-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoate.
| Compound Name | methyl 3-[(3-bromo-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 133350091 |
| Molecular Formula | C13H18BrN3O4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | methyl 3-[(3-bromo-5-nitro-2-pyridinyl)amino]-2,2,3-trimethylbutanoate |
| SMILES | COC(=O)C(C)(C)C(C)(C)Nc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H18BrN3O4/c1-12(2,11(18)21-5)13(3,4)16-10-9(14)6-8(7-15-10)17(19)20/h6-7H,1-5H3,(H,15,16) |
| InChIKey | AREPDGOIWQXOHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|