C14H19ClN2O4 — CID 133350071
methyl 3-(2-chloro-4-nitroanilino)-2,2,3-trimethylbutanoate (PubChem CID 133350071) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 3-(2-chloro-4-nitroanilino)-2,2,3-trimethylbutanoate.
| Compound Name | methyl 3-(2-chloro-4-nitroanilino)-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 133350071 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 3-(2-chloro-4-nitroanilino)-2,2,3-trimethylbutanoate |
| SMILES | COC(=O)C(C)(C)C(C)(C)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H19ClN2O4/c1-13(2,12(18)21-5)14(3,4)16-11-7-6-9(17(19)20)8-10(11)15/h6-8,16H,1-5H3 |
| InChIKey | OZTZRIOJHZPCHL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|