C14H9Cl5N4O4 — CID 20980486
1,1,2-trichloro-N,N'-bis(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 20980486) has the molecular formula C14H9Cl5N4O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1,1,2-trichloro-N,N'-bis(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | 1,1,2-trichloro-N,N'-bis(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 20980486 |
| Molecular Formula | C14H9Cl5N4O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 471.91 |
| IUPAC Name | 1,1,2-trichloro-N,N'-bis(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NC(Cl)C(Cl)(Cl)Nc2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl5N4O4/c15-9-5-7(22(24)25)1-3-11(9)20-13(17)14(18,19)21-12-4-2-8(23(26)27)6-10(12)16/h1-6,13,20-21H |
| InChIKey | VJOFIQZHTHTMOO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|