C12H18BrN3O3 — CID 103730038
3-[[(3-bromo-5-nitro-2-pyridinyl)amino]methyl]hexan-1-ol (PubChem CID 103730038) has the molecular formula C12H18BrN3O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is 3-[[(3-bromo-5-nitro-2-pyridinyl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(3-bromo-5-nitro-2-pyridinyl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103730038 |
| Molecular Formula | C12H18BrN3O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-[[(3-bromo-5-nitro-2-pyridinyl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C12H18BrN3O3/c1-2-3-9(4-5-17)7-14-12-11(13)6-10(8-15-12)16(18)19/h6,8-9,17H,2-5,7H2,1H3,(H,14,15) |
| InChIKey | SFLOGOGJHFWAHU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|