C11H11ClN4O2S — CID 65245310
6-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 65245310) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is 6-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 65245310 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(CNc2ncnc(Cl)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C11H11ClN4O2S/c1-6-3-8(19-7(6)2)4-13-11-9(16(17)18)10(12)14-5-15-11/h3,5H,4H2,1-2H3,(H,13,14,15) |
| InChIKey | FJXUDCNJEAHACH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|