C13H12Cl2N2O2S — CID 106891602
2,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-nitroaniline (PubChem CID 106891602) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 106891602 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-nitroaniline |
| SMILES | Cc1cc(CNc2c(Cl)cc([N+](=O)[O-])cc2Cl)sc1C |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-7-3-10(20-8(7)2)6-16-13-11(14)4-9(17(18)19)5-12(13)15/h3-5,16H,6H2,1-2H3 |
| InChIKey | IOHAOAXWYHOJPW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|