C10H9Cl2N5O2 — CID 133484874
2,6-dichloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-nitroaniline (PubChem CID 133484874) has the molecular formula C10H9Cl2N5O2 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 133484874 |
| Molecular Formula | C10H9Cl2N5O2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2,6-dichloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-nitroaniline |
| SMILES | Cn1ncnc1CNc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H9Cl2N5O2/c1-16-9(14-5-15-16)4-13-10-7(11)2-6(17(18)19)3-8(10)12/h2-3,5,13H,4H2,1H3 |
| InChIKey | TTYFZTSGPRJRAI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|