C10H9Cl2FN4 — CID 103579745
3,5-dichloro-4-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline (PubChem CID 103579745) has the molecular formula C10H9Cl2FN4 and a molecular weight of 275.11 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 103579745 |
| Molecular Formula | C10H9Cl2FN4 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
| SMILES | Cn1ncnc1CNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2FN4/c1-17-9(15-5-16-17)4-14-6-2-7(11)10(13)8(12)3-6/h2-3,5,14H,4H2,1H3 |
| InChIKey | VPDLGUIODQJSMW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|