C10H11ClN4 — CID 62695858
3-chloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline (PubChem CID 62695858) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 3-chloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline.
| Compound Name | 3-chloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 62695858 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-chloro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
| SMILES | Cn1ncnc1CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClN4/c1-15-10(13-7-14-15)6-12-9-4-2-3-8(11)5-9/h2-5,7,12H,6H2,1H3 |
| InChIKey | OWCJZKDTKNBOTR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |