C20H18N4O2 — CID 75512732
methyl 3-[2-[3-[(2-methyl-1,2,4-triazol-3-yl)methylamino]phenyl]ethynyl]benzoate (PubChem CID 75512732) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 3-[2-[3-[(2-methyl-1,2,4-triazol-3-yl)methylamino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[(2-methyl-1,2,4-triazol-3-yl)methylamino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 75512732 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 3-[2-[3-[(2-methyl-1,2,4-triazol-3-yl)methylamino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NCc3ncnn3C)c2)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-24-19(22-14-23-24)13-21-18-8-4-6-16(12-18)10-9-15-5-3-7-17(11-15)20(25)26-2/h3-8,11-12,14,21H,13H2,1-2H3 |
| InChIKey | UHTIHHKHHFZHBW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|