C26H20N4O3 — CID 46539284
methyl 3-[2-[3-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]phenyl]ethynyl]benzoate (PubChem CID 46539284) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 3-[2-[3-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 46539284 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 3-[2-[3-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3ccc(Cn4cncn4)cc3)c2)c1 |
| InChI | InChI=1S/C26H20N4O3/c1-33-26(32)23-6-2-4-19(14-23)8-9-20-5-3-7-24(15-20)29-25(31)22-12-10-21(11-13-22)16-30-18-27-17-28-30/h2-7,10-15,17-18H,16H2,1H3,(H,29,31) |
| InChIKey | NVALJKNJAYHURF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|