C16H16ClN3 — CID 60835526
3-chloro-N-[(1,5-dimethylbenzimidazol-2-yl)methyl]aniline (PubChem CID 60835526) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 3-chloro-N-[(1,5-dimethylbenzimidazol-2-yl)methyl]aniline.
| Compound Name | 3-chloro-N-[(1,5-dimethylbenzimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 60835526 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-chloro-N-[(1,5-dimethylbenzimidazol-2-yl)methyl]aniline |
| SMILES | Cc1ccc2c(c1)nc(CNc1cccc(Cl)c1)n2C |
| InChI | InChI=1S/C16H16ClN3/c1-11-6-7-15-14(8-11)19-16(20(15)2)10-18-13-5-3-4-12(17)9-13/h3-9,18H,10H2,1-2H3 |
| InChIKey | GCBQMNHRHFFPFJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |