C11H14N2S — CID 82333350
2-(1,5-dimethylbenzimidazol-2-yl)ethanethiol (PubChem CID 82333350) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-(1,5-dimethylbenzimidazol-2-yl)ethanethiol.
| Compound Name | 2-(1,5-dimethylbenzimidazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 82333350 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(1,5-dimethylbenzimidazol-2-yl)ethanethiol |
| SMILES | Cc1ccc2c(c1)nc(CCS)n2C |
| InChI | InChI=1S/C11H14N2S/c1-8-3-4-10-9(7-8)12-11(5-6-14)13(10)2/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | AMNXVEJADIKIQR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|