C17H19N3 — CID 115339576
3-[2-(1,5-dimethylbenzimidazol-2-yl)ethyl]aniline (PubChem CID 115339576) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[2-(1,5-dimethylbenzimidazol-2-yl)ethyl]aniline.
| Compound Name | 3-[2-(1,5-dimethylbenzimidazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115339576 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-[2-(1,5-dimethylbenzimidazol-2-yl)ethyl]aniline |
| SMILES | Cc1ccc2c(c1)nc(CCc1cccc(N)c1)n2C |
| InChI | InChI=1S/C17H19N3/c1-12-6-8-16-15(10-12)19-17(20(16)2)9-7-13-4-3-5-14(18)11-13/h3-6,8,10-11H,7,9,18H2,1-2H3 |
| InChIKey | ZAPHDVLCEIEZIH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|