C11H13ClN4S — CID 113431866
3-chloro-N-[2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline (PubChem CID 113431866) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-chloro-N-[2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline.
| Compound Name | 3-chloro-N-[2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline |
|---|---|
| PubChem CID | 113431866 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-chloro-N-[2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline |
| SMILES | Cn1ncnc1SCCNc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN4S/c1-16-11(14-8-15-16)17-6-5-13-10-4-2-3-9(12)7-10/h2-4,7-8,13H,5-6H2,1H3 |
| InChIKey | UTDSBIGHXOQDQN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|