C13H16ClN5OS — CID 104602993
N-(2-amino-4-chlorophenyl)-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 104602993) has the molecular formula C13H16ClN5OS and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 104602993 |
| Molecular Formula | C13H16ClN5OS |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | Cn1ncnc1SCCCC(=O)Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C13H16ClN5OS/c1-19-13(16-8-17-19)21-6-2-3-12(20)18-11-5-4-9(14)7-10(11)15/h4-5,7-8H,2-3,6,15H2,1H3,(H,18,20) |
| InChIKey | IJJXFAUQZAFFIZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|