C11H12ClN5O2S — CID 62897884
N-(2-amino-4-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 62897884) has the molecular formula C11H12ClN5O2S and a molecular weight of 313.77 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 62897884 |
| Molecular Formula | C11H12ClN5O2S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc(Cl)cc2N)n[nH]c1=O |
| InChI | InChI=1S/C11H12ClN5O2S/c1-17-10(19)15-16-11(17)20-5-9(18)14-8-3-2-6(12)4-7(8)13/h2-4H,5,13H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | RBOMNSPXEQATNT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|