C12H14ClN5O2S — CID 62897528
N-(2-amino-5-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 62897528) has the molecular formula C12H14ClN5O2S and a molecular weight of 327.80 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 62897528 |
| Molecular Formula | C12H14ClN5O2S |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(=O)n1C)C(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H14ClN5O2S/c1-6(21-12-17-16-11(20)18(12)2)10(19)15-9-5-7(13)3-4-8(9)14/h3-6H,14H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | QQRJXLVBDIDEJV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|