C10H13ClN2OS — CID 61023322
N-(2-amino-5-chlorophenyl)-2-methylsulfanylpropanamide (PubChem CID 61023322) has the molecular formula C10H13ClN2OS and a molecular weight of 244.75 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-methylsulfanylpropanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 61023322 |
| Molecular Formula | C10H13ClN2OS |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C10H13ClN2OS/c1-6(15-2)10(14)13-9-5-7(11)3-4-8(9)12/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | ICBXRFRFEVEPMY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|