C11H12ClF3N2O2 — CID 16794251
N-(2-amino-5-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 16794251) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 16794251 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(OCC(F)(F)F)C(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C11H12ClF3N2O2/c1-6(19-5-11(13,14)15)10(18)17-9-4-7(12)2-3-8(9)16/h2-4,6H,5,16H2,1H3,(H,17,18) |
| InChIKey | KPTSPBORAJPDLT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|