C13H14ClF3N2O3 — CID 38938244
(2R)-N-(4-acetamido-3-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 38938244) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is (2R)-N-(4-acetamido-3-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-(4-acetamido-3-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 38938244 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2R)-N-(4-acetamido-3-chlorophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)OCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H14ClF3N2O3/c1-7(22-6-13(15,16)17)12(21)19-9-3-4-11(10(14)5-9)18-8(2)20/h3-5,7H,6H2,1-2H3,(H,18,20)(H,19,21)/t7-/m1/s1 |
| InChIKey | JLXUUAXFEIOGNR-SSDOTTSWSA-N |
| XLogP | 3.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |