C11H11F3N2O4 — CID 38925963
(2R)-N-(3-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 38925963) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is (2R)-N-(3-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-(3-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 38925963 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (2R)-N-(3-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | C[C@@H](OCC(F)(F)F)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11F3N2O4/c1-7(20-6-11(12,13)14)10(17)15-8-3-2-4-9(5-8)16(18)19/h2-5,7H,6H2,1H3,(H,15,17)/t7-/m1/s1 |
| InChIKey | CUYWTMRDXTZSOO-SSDOTTSWSA-N |
| XLogP | 2.50 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|