C14H17F3N2O3 — CID 51725511
N-ethyl-3-[[(2S)-2-(2,2,2-trifluoroethoxy)propanoyl]amino]benzamide (PubChem CID 51725511) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is N-ethyl-3-[[(2S)-2-(2,2,2-trifluoroethoxy)propanoyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[(2S)-2-(2,2,2-trifluoroethoxy)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 51725511 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-ethyl-3-[[(2S)-2-(2,2,2-trifluoroethoxy)propanoyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)[C@H](C)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-3-18-13(21)10-5-4-6-11(7-10)19-12(20)9(2)22-8-14(15,16)17/h4-7,9H,3,8H2,1-2H3,(H,18,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | NAGCPMPKKOTOIU-VIFPVBQESA-N |
| XLogP | 2.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |