C18H15F3N2O5 — CID 78873840
N-(2-benzoyl-4-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 78873840) has the molecular formula C18H15F3N2O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is N-(2-benzoyl-4-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-benzoyl-4-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 78873840 |
| Molecular Formula | C18H15F3N2O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-(2-benzoyl-4-nitrophenyl)-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(OCC(F)(F)F)C(=O)Nc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O5/c1-11(28-10-18(19,20)21)17(25)22-15-8-7-13(23(26)27)9-14(15)16(24)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,22,25) |
| InChIKey | YXCRREADDPLMBN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|