C15H10Cl2N2O4 — CID 154108561
N-(2-benzoyl-4-nitrophenyl)-2,2-dichloroacetamide (PubChem CID 154108561) has the molecular formula C15H10Cl2N2O4 and a molecular weight of 353.16 g/mol. Its IUPAC name is N-(2-benzoyl-4-nitrophenyl)-2,2-dichloroacetamide.
| Compound Name | N-(2-benzoyl-4-nitrophenyl)-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 154108561 |
| Molecular Formula | C15H10Cl2N2O4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-(2-benzoyl-4-nitrophenyl)-2,2-dichloroacetamide |
| SMILES | O=C(c1ccccc1)c1cc([N+](=O)[O-])ccc1NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C15H10Cl2N2O4/c16-14(17)15(21)18-12-7-6-10(19(22)23)8-11(12)13(20)9-4-2-1-3-5-9/h1-8,14H,(H,18,21) |
| InChIKey | MZXRUCPKHALGHH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|