C27H20N2O4 — CID 11026488
N-(2-benzoyl-4-nitrophenyl)-2,2-diphenylacetamide (PubChem CID 11026488) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-(2-benzoyl-4-nitrophenyl)-2,2-diphenylacetamide.
| Compound Name | N-(2-benzoyl-4-nitrophenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 11026488 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(2-benzoyl-4-nitrophenyl)-2,2-diphenylacetamide |
| SMILES | O=C(c1ccccc1)c1cc([N+](=O)[O-])ccc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O4/c30-26(21-14-8-3-9-15-21)23-18-22(29(32)33)16-17-24(23)28-27(31)25(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-18,25H,(H,28,31) |
| InChIKey | RVWRECMUDCFXBY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|