C19H15N3O3 — CID 2867447
N-(5-nitro-2-pyridinyl)-2,2-diphenylacetamide (PubChem CID 2867447) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-(5-nitro-2-pyridinyl)-2,2-diphenylacetamide.
| Compound Name | N-(5-nitro-2-pyridinyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2867447 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(5-nitro-2-pyridinyl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O3/c23-19(21-17-12-11-16(13-20-17)22(24)25)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,18H,(H,20,21,23) |
| InChIKey | OAHDADQHLVOJTK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|