C17H13N3O3S — CID 4598640
N-(5-nitro-1,3-thiazol-2-yl)-2,2-diphenylacetamide (PubChem CID 4598640) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-2,2-diphenylacetamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4598640 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O3S/c21-16(19-17-18-11-14(24-17)20(22)23)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,15H,(H,18,19,21) |
| InChIKey | BPICRUXEWBUTRR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|