C9H14N4O3S — CID 110482466
(2S)-2-amino-4-methyl-N-(5-nitro-1,3-thiazol-2-yl)pentanamide (PubChem CID 110482466) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-(5-nitro-1,3-thiazol-2-yl)pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-(5-nitro-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 110482466 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-(5-nitro-1,3-thiazol-2-yl)pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H14N4O3S/c1-5(2)3-6(10)8(14)12-9-11-4-7(17-9)13(15)16/h4-6H,3,10H2,1-2H3,(H,11,12,14)/t6-/m0/s1 |
| InChIKey | VOUGOBHJZMDEGJ-LURJTMIESA-N |
| XLogP | 1.36 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|