C7H12N4O3S — CID 102771365
3-amino-4-[(5-nitro-1,3-thiazol-2-yl)amino]butan-2-ol (PubChem CID 102771365) has the molecular formula C7H12N4O3S and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-amino-4-[(5-nitro-1,3-thiazol-2-yl)amino]butan-2-ol.
| Compound Name | 3-amino-4-[(5-nitro-1,3-thiazol-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 102771365 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-amino-4-[(5-nitro-1,3-thiazol-2-yl)amino]butan-2-ol |
| SMILES | CC(O)C(N)CNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C7H12N4O3S/c1-4(12)5(8)2-9-7-10-3-6(15-7)11(13)14/h3-5,12H,2,8H2,1H3,(H,9,10) |
| InChIKey | ZJGBMRFLHFCMPH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|