C11H11N3O4S — CID 11601592
4-[1-hydroxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]phenol (PubChem CID 11601592) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]phenol.
| Compound Name | 4-[1-hydroxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 11601592 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-[1-hydroxy-2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]phenol |
| SMILES | O=[N+]([O-])c1cnc(NCC(O)c2ccc(O)cc2)s1 |
| InChI | InChI=1S/C11H11N3O4S/c15-8-3-1-7(2-4-8)9(16)5-12-11-13-6-10(19-11)14(17)18/h1-4,6,9,15-16H,5H2,(H,12,13) |
| InChIKey | ASMPDUABBZAJFC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|