C8H14N4O2S — CID 102771295
N-(5-nitro-1,3-thiazol-2-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 102771295) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 102771295 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H14N4O2S/c1-6(2)9-3-4-10-8-11-5-7(15-8)12(13)14/h5-6,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | VAZRYKKUVSXNQW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|