C10H16N4O4S — CID 102771164
tert-butyl N-[2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]carbamate (PubChem CID 102771164) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 102771164 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | tert-butyl N-[2-[(5-nitro-1,3-thiazol-2-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H16N4O4S/c1-10(2,3)18-9(15)12-5-4-11-8-13-6-7(19-8)14(16)17/h6H,4-5H2,1-3H3,(H,11,13)(H,12,15) |
| InChIKey | MTCZTADXIIWCIF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|