C10H17N3O4S — CID 102771044
N-[4-(2-methoxyethoxy)butyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 102771044) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)butyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[4-(2-methoxyethoxy)butyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102771044 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[4-(2-methoxyethoxy)butyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | COCCOCCCCNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H17N3O4S/c1-16-6-7-17-5-3-2-4-11-10-12-8-9(18-10)13(14)15/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | OJRDURWPMVUBPH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|