C8H13N3O3S — CID 102771057
N-(1-methoxy-2-methylpropan-2-yl)-5-nitro-1,3-thiazol-2-amine (PubChem CID 102771057) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is N-(1-methoxy-2-methylpropan-2-yl)-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-(1-methoxy-2-methylpropan-2-yl)-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102771057 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | N-(1-methoxy-2-methylpropan-2-yl)-5-nitro-1,3-thiazol-2-amine |
| SMILES | COCC(C)(C)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H13N3O3S/c1-8(2,5-14-3)10-7-9-4-6(15-7)11(12)13/h4H,5H2,1-3H3,(H,9,10) |
| InChIKey | WHOQVGSUXMTQOV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|