C11H17N3O2S — CID 106013018
N-(3-cyclopentylpropyl)-5-nitro-1,3-thiazol-2-amine (PubChem CID 106013018) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-(3-cyclopentylpropyl)-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106013018 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(3-cyclopentylpropyl)-5-nitro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCCC2CCCC2)s1 |
| InChI | InChI=1S/C11H17N3O2S/c15-14(16)10-8-13-11(17-10)12-7-3-6-9-4-1-2-5-9/h8-9H,1-7H2,(H,12,13) |
| InChIKey | LSEWLHAXKFZFDK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|