C6H9N3O3S — CID 102770428
3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-1-ol (PubChem CID 102770428) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 102770428 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-1-ol |
| SMILES | O=[N+]([O-])c1cnc(NCCCO)s1 |
| InChI | InChI=1S/C6H9N3O3S/c10-3-1-2-7-6-8-4-5(13-6)9(11)12/h4,10H,1-3H2,(H,7,8) |
| InChIKey | KLCQFJUFMBQTKY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|