C8H10N6O2S — CID 102771034
5-nitro-N-[3-(triazol-1-yl)propyl]-1,3-thiazol-2-amine (PubChem CID 102771034) has the molecular formula C8H10N6O2S and a molecular weight of 254.27 g/mol. Its IUPAC name is 5-nitro-N-[3-(triazol-1-yl)propyl]-1,3-thiazol-2-amine.
| Compound Name | 5-nitro-N-[3-(triazol-1-yl)propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102771034 |
| Molecular Formula | C8H10N6O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-nitro-N-[3-(triazol-1-yl)propyl]-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCCn2ccnn2)s1 |
| InChI | InChI=1S/C8H10N6O2S/c15-14(16)7-6-10-8(17-7)9-2-1-4-13-5-3-11-12-13/h3,5-6H,1-2,4H2,(H,9,10) |
| InChIKey | FXJGCBZXPHBFLC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|