C7H6N4O2S — CID 102770909
5-nitro-N-pyrrol-1-yl-1,3-thiazol-2-amine (PubChem CID 102770909) has the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. Its IUPAC name is 5-nitro-N-pyrrol-1-yl-1,3-thiazol-2-amine.
| Compound Name | 5-nitro-N-pyrrol-1-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102770909 |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-nitro-N-pyrrol-1-yl-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nn2cccc2)s1 |
| InChI | InChI=1S/C7H6N4O2S/c12-11(13)6-5-8-7(14-6)9-10-3-1-2-4-10/h1-5H,(H,8,9) |
| InChIKey | RGHCQVLXVPOKCT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|