C8H9N3O4S — CID 102769964
1-[[(5-nitro-1,3-thiazol-2-yl)amino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 102769964) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is 1-[[(5-nitro-1,3-thiazol-2-yl)amino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(5-nitro-1,3-thiazol-2-yl)amino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 102769964 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-[[(5-nitro-1,3-thiazol-2-yl)amino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNc2ncc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C8H9N3O4S/c12-6(13)8(1-2-8)4-10-7-9-3-5(16-7)11(14)15/h3H,1-2,4H2,(H,9,10)(H,12,13) |
| InChIKey | CNRWGAFSBZJQSE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|