C6H8N4O4S — CID 106171071
2-hydroxy-3-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide (PubChem CID 106171071) has the molecular formula C6H8N4O4S and a molecular weight of 232.22 g/mol. Its IUPAC name is 2-hydroxy-3-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide.
| Compound Name | 2-hydroxy-3-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 106171071 |
| Molecular Formula | C6H8N4O4S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-hydroxy-3-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide |
| SMILES | NC(=O)C(O)CNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C6H8N4O4S/c7-5(12)3(11)1-8-6-9-2-4(15-6)10(13)14/h2-3,11H,1H2,(H2,7,12)(H,8,9) |
| InChIKey | HNLDYRCSXUBEQA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|