C9H16N4O3S — CID 114149789
1-(dimethylamino)-2-methyl-3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-2-ol (PubChem CID 114149789) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 114149789 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-[(5-nitro-1,3-thiazol-2-yl)amino]propan-2-ol |
| SMILES | CN(C)CC(C)(O)CNc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H16N4O3S/c1-9(14,6-12(2)3)5-11-8-10-4-7(17-8)13(15)16/h4,14H,5-6H2,1-3H3,(H,10,11) |
| InChIKey | CQYZCNNBZCGEMD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|