C7H9N5O4 — CID 106170845
2-hydroxy-3-[(5-nitropyrimidin-2-yl)amino]propanamide (PubChem CID 106170845) has the molecular formula C7H9N5O4 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-hydroxy-3-[(5-nitropyrimidin-2-yl)amino]propanamide.
| Compound Name | 2-hydroxy-3-[(5-nitropyrimidin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 106170845 |
| Molecular Formula | C7H9N5O4 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-hydroxy-3-[(5-nitropyrimidin-2-yl)amino]propanamide |
| SMILES | NC(=O)C(O)CNc1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C7H9N5O4/c8-6(14)5(13)3-11-7-9-1-4(2-10-7)12(15)16/h1-2,5,13H,3H2,(H2,8,14)(H,9,10,11) |
| InChIKey | CUEDORDFOWSRID-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|