C9H15N5O2 — CID 115303176
N,2-dimethyl-N'-(5-nitropyrimidin-2-yl)propane-1,3-diamine (PubChem CID 115303176) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is N,2-dimethyl-N'-(5-nitropyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N,2-dimethyl-N'-(5-nitropyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115303176 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N,2-dimethyl-N'-(5-nitropyrimidin-2-yl)propane-1,3-diamine |
| SMILES | CNCC(C)CNc1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H15N5O2/c1-7(3-10-2)4-11-9-12-5-8(6-13-9)14(15)16/h5-7,10H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | OXWFXSSJPUBYQY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|