C7H7F3N4O3 — CID 113434396
1,1,1-trifluoro-3-[(5-nitropyrimidin-2-yl)amino]propan-2-ol (PubChem CID 113434396) has the molecular formula C7H7F3N4O3 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(5-nitropyrimidin-2-yl)amino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(5-nitropyrimidin-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 113434396 |
| Molecular Formula | C7H7F3N4O3 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1,1,1-trifluoro-3-[(5-nitropyrimidin-2-yl)amino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cnc(NCC(O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C7H7F3N4O3/c8-7(9,10)5(15)3-13-6-11-1-4(2-12-6)14(16)17/h1-2,5,15H,3H2,(H,11,12,13) |
| InChIKey | VYPBQFQGXVKTND-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|